C18H18N2O4 — CID 67890998
1,4,6-trimethyl-9-(4-methylphenyl)-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone (PubChem CID 67890998) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 1,4,6-trimethyl-9-(4-methylphenyl)-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone.
| Compound Name | 1,4,6-trimethyl-9-(4-methylphenyl)-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
|---|---|
| PubChem CID | 67890998 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1,4,6-trimethyl-9-(4-methylphenyl)-4,9-diazatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| SMILES | Cc1ccc(N2C(=O)C3C4(C)C(=O)N(C)C(=O)C4C3(C)C2=O)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-9-5-7-10(8-6-9)20-14(22)12-17(2)11(18(12,3)16(20)24)13(21)19(4)15(17)23/h5-8,11-12H,1-4H3 |
| InChIKey | KSNPYMNYFDSYPN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|