C26H31FN2O5 — CID 67891462
1-O-benzyl 4-O-tert-butyl (3aR,6S,6aS)-6-[(4-fluorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate (PubChem CID 67891462) has the molecular formula C26H31FN2O5 and a molecular weight of 470.54 g/mol. Its IUPAC name is 1-O-benzyl 4-O-tert-butyl (3aR,6S,6aS)-6-[(4-fluorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate.
| Compound Name | 1-O-benzyl 4-O-tert-butyl (3aR,6S,6aS)-6-[(4-fluorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate |
|---|---|
| PubChem CID | 67891462 |
| Molecular Formula | C26H31FN2O5 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1-O-benzyl 4-O-tert-butyl (3aR,6S,6aS)-6-[(4-fluorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](OCc2ccc(F)cc2)[C@@H]2[C@H]1CCN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H31FN2O5/c1-26(2,3)34-25(31)29-15-22(32-16-19-9-11-20(27)12-10-19)23-21(29)13-14-28(23)24(30)33-17-18-7-5-4-6-8-18/h4-12,21-23H,13-17H2,1-3H3/t21-,22+,23+/m1/s1 |
| InChIKey | QAWVYJLVKZPBNC-VJBWXMMDSA-N |
| XLogP | 4.74 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |