C37H34N2 — CID 67891632
N-[4-[5,6-bis(ethenyl)-3-methyl-4-(2-methylphenyl)cyclohexa-1,3-dien-1-yl]phenyl]-N-phenylbenzenecarboximidamide (PubChem CID 67891632) has the molecular formula C37H34N2 and a molecular weight of 506.69 g/mol. Its IUPAC name is N-[4-[5,6-bis(ethenyl)-3-methyl-4-(2-methylphenyl)cyclohexa-1,3-dien-1-yl]phenyl]-N-phenylbenzenecarboximidamide.
| Compound Name | N-[4-[5,6-bis(ethenyl)-3-methyl-4-(2-methylphenyl)cyclohexa-1,3-dien-1-yl]phenyl]-N-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 67891632 |
| Molecular Formula | C37H34N2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | N-[4-[5,6-bis(ethenyl)-3-methyl-4-(2-methylphenyl)cyclohexa-1,3-dien-1-yl]phenyl]-N-phenylbenzenecarboximidamide |
| SMILES | [H]/N=C(\c1ccccc1)N(c1ccccc1)c1ccc(C2=CC(C)=C(c3ccccc3C)C(C=C)C2C=C)cc1 |
| InChI | InChI=1S/C37H34N2/c1-5-32-33(6-2)36(34-20-14-13-15-26(34)3)27(4)25-35(32)28-21-23-31(24-22-28)39(30-18-11-8-12-19-30)37(38)29-16-9-7-10-17-29/h5-25,32-33,38H,1-2H2,3-4H3/b38-37+ |
| InChIKey | RUHPPVBOXMRLGU-HEFFKOSUSA-N |
| XLogP | 9.63 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|