About 1,5-diamino-2H-indol-3-one
1,5-diamino-2H-indol-3-one (PubChem CID 67892011) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 1,5-diamino-2H-indol-3-one.
Molecular Properties
| Compound Name | 1,5-diamino-2H-indol-3-one |
| PubChem CID | 67892011 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 1,5-diamino-2H-indol-3-one |
| SMILES | Nc1ccc2c(c1)C(=O)CN2N |
| InChI | InChI=1S/C8H9N3O/c9-5-1-2-7-6(3-5)8(12)4-11(7)10/h1-3H,4,9-10H2 |
| InChIKey | UKUKURHSPHORDP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1,5-diamino-2H-indol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diamino-2H-indol-3-one?
The IUPAC name of 1,5-diamino-2H-indol-3-one (CID 67892011) is 1,5-diamino-2H-indol-3-one.
What is the SMILES notation for 1,5-diamino-2H-indol-3-one?
The canonical SMILES for 1,5-diamino-2H-indol-3-one is Nc1ccc2c(c1)C(=O)CN2N.
What is the InChIKey of 1,5-diamino-2H-indol-3-one?
The InChIKey is UKUKURHSPHORDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c9-5-1-2-7-6(3-5)8(12)4-11(7)10/h1-3H,4,9-10H2.
What are the key properties of 1,5-diamino-2H-indol-3-one?
1,5-diamino-2H-indol-3-one has a molecular weight of 163.18 g/mol, XLogP of 0.15, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diamino-2H-indol-3-one is sourced from PubChem (CID 67892011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).