About 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine
1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine (PubChem CID 67892069) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine.
Molecular Properties
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine |
| PubChem CID | 67892069 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine |
| SMILES | CCNC(C)C1=CC=CCC1 |
| InChI | InChI=1S/C10H17N/c1-3-11-9(2)10-7-5-4-6-8-10/h4-5,7,9,11H,3,6,8H2,1-2H3 |
| InChIKey | NENGIFPMBUJKIL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine?
The IUPAC name of 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine (CID 67892069) is 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine is CCNC(C)C1=CC=CCC1.
What is the InChIKey of 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine?
The InChIKey is NENGIFPMBUJKIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-3-11-9(2)10-7-5-4-6-8-10/h4-5,7,9,11H,3,6,8H2,1-2H3.
What are the key properties of 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine?
1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine has a molecular weight of 151.25 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-yl-N-ethylethanamine is sourced from PubChem (CID 67892069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).