C25H37FN4O5 — CID 67892156
tert-butyl N-[2-[(3aR,6S,6aS)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-6-(4-fluorophenoxy)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-oxoethyl]carbamate (PubChem CID 67892156) has the molecular formula C25H37FN4O5 and a molecular weight of 492.59 g/mol. Its IUPAC name is tert-butyl N-[2-[(3aR,6S,6aS)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-6-(4-fluorophenoxy)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3aR,6S,6aS)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-6-(4-fluorophenoxy)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 67892156 |
| Molecular Formula | C25H37FN4O5 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | tert-butyl N-[2-[(3aR,6S,6aS)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-6-(4-fluorophenoxy)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1C[C@H](Oc2ccc(F)cc2)[C@@H]2[C@H]1CCN2C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C25H37FN4O5/c1-24(2,3)21(27)22(32)29-12-11-17-20(29)18(34-16-9-7-15(26)8-10-16)14-30(17)19(31)13-28-23(33)35-25(4,5)6/h7-10,17-18,20-21H,11-14,27H2,1-6H3,(H,28,33)/t17-,18+,20+,21-/m1/s1 |
| InChIKey | DMNSGKAYOJXBLZ-YXYSEUPNSA-N |
| XLogP | 2.28 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |