C13H17Cl2NO — CID 67892267
N-(2-tert-butylphenyl)-2,3-dichloropropanamide (PubChem CID 67892267) has the molecular formula C13H17Cl2NO and a molecular weight of 274.19 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-2,3-dichloropropanamide.
| Compound Name | N-(2-tert-butylphenyl)-2,3-dichloropropanamide |
|---|---|
| PubChem CID | 67892267 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N-(2-tert-butylphenyl)-2,3-dichloropropanamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)C(Cl)CCl |
| InChI | InChI=1S/C13H17Cl2NO/c1-13(2,3)9-6-4-5-7-11(9)16-12(17)10(15)8-14/h4-7,10H,8H2,1-3H3,(H,16,17) |
| InChIKey | CGKMSGWBZPTBFC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|