About 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea
1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea (PubChem CID 67892431) has the molecular formula C35H55N3O
and a molecular weight of 533.85 g/mol. Its IUPAC name is 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea.
Molecular Properties
| Compound Name | 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea |
| PubChem CID | 67892431 |
| Molecular Formula | C35H55N3O |
| Molecular Weight | 533.85 g/mol |
| Exact Mass | 533.43 |
| IUPAC Name | 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea |
| SMILES | CCCCN(CCCC)c1ccc(C2(CNC(=O)Nc3c(C(C)CC)cccc3C(C)CC)CCCC2)cc1 |
| InChI | InChI=1S/C35H55N3O/c1-7-11-24-38(25-12-8-2)30-20-18-29(19-21-30)35(22-13-14-23-35)26-36-34(39)37-33-31(27(5)9-3)16-15-17-32(33)28(6)10-4/h15-21,27-28H,7-14,22-26H2,1-6H3,(H2,36,37,39) |
| InChIKey | UHBVNNCUTDKFJU-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.85 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea?
The IUPAC name of 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea (CID 67892431) is 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea.
What is the SMILES notation for 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea?
The canonical SMILES for 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea is CCCCN(CCCC)c1ccc(C2(CNC(=O)Nc3c(C(C)CC)cccc3C(C)CC)CCCC2)cc1.
What is the InChIKey of 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea?
The InChIKey is UHBVNNCUTDKFJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H55N3O/c1-7-11-24-38(25-12-8-2)30-20-18-29(19-21-30)35(22-13-14-23-35)26-36-34(39)37-33-31(27(5)9-3)16-15-17-32(33)28(6)10-4/h15-21,27-28H,7-14,22-26H2,1-6H3,(H2,36,37,39).
What are the key properties of 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea?
1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea has a molecular weight of 533.85 g/mol, XLogP of 9.75, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-di(butan-2-yl)phenyl]-3-[[1-[4-(dibutylamino)phenyl]cyclopentyl]methyl]urea is sourced from PubChem (CID 67892431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).