About 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one
2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one (PubChem CID 67892439) has the molecular formula C16H28O
and a molecular weight of 236.40 g/mol. Its IUPAC name is 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one.
Molecular Properties
| Compound Name | 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one |
| PubChem CID | 67892439 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one |
| SMILES | CCC(=O)C(C)CC1CC2CC(C1C)C2(C)C |
| InChI | InChI=1S/C16H28O/c1-6-15(17)10(2)7-12-8-13-9-14(11(12)3)16(13,4)5/h10-14H,6-9H2,1-5H3 |
| InChIKey | VAJUHIXBTAMPMR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one?
The IUPAC name of 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one (CID 67892439) is 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one.
What is the SMILES notation for 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one?
The canonical SMILES for 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one is CCC(=O)C(C)CC1CC2CC(C1C)C2(C)C.
What is the InChIKey of 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one?
The InChIKey is VAJUHIXBTAMPMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O/c1-6-15(17)10(2)7-12-8-13-9-14(11(12)3)16(13,4)5/h10-14H,6-9H2,1-5H3.
What are the key properties of 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one?
2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one has a molecular weight of 236.40 g/mol, XLogP of 4.31, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)pentan-3-one is sourced from PubChem (CID 67892439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).