About N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine
N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine (PubChem CID 67892751) has the molecular formula C22H35NO2S
and a molecular weight of 377.59 g/mol. Its IUPAC name is N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine.
Molecular Properties
| Compound Name | N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine |
| PubChem CID | 67892751 |
| Molecular Formula | C22H35NO2S |
| Molecular Weight | 377.59 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine |
| SMILES | CCN(CCCC#CC(C)(C)C)CCOCCOCC=Cc1ccsc1 |
| InChI | InChI=1S/C22H35NO2S/c1-5-23(13-8-6-7-12-22(2,3)4)14-16-25-18-17-24-15-9-10-21-11-19-26-20-21/h9-11,19-20H,5-6,8,13-18H2,1-4H3 |
| InChIKey | UDCOPBMHZRFQOO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine?
The IUPAC name of N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine (CID 67892751) is N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine.
What is the SMILES notation for N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine?
The canonical SMILES for N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine is CCN(CCCC#CC(C)(C)C)CCOCCOCC=Cc1ccsc1.
What is the InChIKey of N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine?
The InChIKey is UDCOPBMHZRFQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35NO2S/c1-5-23(13-8-6-7-12-22(2,3)4)14-16-25-18-17-24-15-9-10-21-11-19-26-20-21/h9-11,19-20H,5-6,8,13-18H2,1-4H3.
What are the key properties of N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine?
N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine has a molecular weight of 377.59 g/mol, XLogP of 4.95, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6,6-dimethyl-N-[2-[2-(3-thiophen-3-ylprop-2-enoxy)ethoxy]ethyl]hept-4-yn-1-amine is sourced from PubChem (CID 67892751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).