C15H18O7 — CID 67892849
4-[2-(2-methylprop-2-enoxy)ethyl]cyclohexa-2,5-diene-1,2,4-tricarboxylic acid (PubChem CID 67892849) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is 4-[2-(2-methylprop-2-enoxy)ethyl]cyclohexa-2,5-diene-1,2,4-tricarboxylic acid.
| Compound Name | 4-[2-(2-methylprop-2-enoxy)ethyl]cyclohexa-2,5-diene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 67892849 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-[2-(2-methylprop-2-enoxy)ethyl]cyclohexa-2,5-diene-1,2,4-tricarboxylic acid |
| SMILES | C=C(C)COCCC1(C(=O)O)C=CC(C(=O)O)C(C(=O)O)=C1 |
| InChI | InChI=1S/C15H18O7/c1-9(2)8-22-6-5-15(14(20)21)4-3-10(12(16)17)11(7-15)13(18)19/h3-4,7,10H,1,5-6,8H2,2H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | ARLFXQMWCXCUJQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|