About 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol
2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol (PubChem CID 67893084) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol.
Molecular Properties
| Compound Name | 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol |
| PubChem CID | 67893084 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol |
| SMILES | CC1=NCC(C(C)CO)N1 |
| InChI | InChI=1S/C7H14N2O/c1-5(4-10)7-3-8-6(2)9-7/h5,7,10H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | XDTUWWIYHWMJOG-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol?
The IUPAC name of 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol (CID 67893084) is 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol.
What is the SMILES notation for 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol?
The canonical SMILES for 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol is CC1=NCC(C(C)CO)N1.
What is the InChIKey of 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol?
The InChIKey is XDTUWWIYHWMJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-5(4-10)7-3-8-6(2)9-7/h5,7,10H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol?
2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol has a molecular weight of 142.20 g/mol, XLogP of 0.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-4,5-dihydro-1H-imidazol-5-yl)propan-1-ol is sourced from PubChem (CID 67893084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).