C20H30O3 — CID 67893204
[(4aR,4bS,7S,8S,8aR)-7-ethyl-7,8-dimethyl-2-oxo-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-4-yl] acetate (PubChem CID 67893204) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is [(4aR,4bS,7S,8S,8aR)-7-ethyl-7,8-dimethyl-2-oxo-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-4-yl] acetate.
| Compound Name | [(4aR,4bS,7S,8S,8aR)-7-ethyl-7,8-dimethyl-2-oxo-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-4-yl] acetate |
|---|---|
| PubChem CID | 67893204 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [(4aR,4bS,7S,8S,8aR)-7-ethyl-7,8-dimethyl-2-oxo-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-4-yl] acetate |
| SMILES | CC[C@@]1(C)CC[C@H]2[C@@H](CCC3=CC(=O)CC(OC(C)=O)[C@@H]32)[C@@H]1C |
| InChI | InChI=1S/C20H30O3/c1-5-20(4)9-8-17-16(12(20)2)7-6-14-10-15(22)11-18(19(14)17)23-13(3)21/h10,12,16-19H,5-9,11H2,1-4H3/t12-,16-,17-,18?,19-,20-/m0/s1 |
| InChIKey | VJDUJFVMQVAIOS-QTEOZBODSA-N |
| XLogP | 4.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |