About 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid
3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid (PubChem CID 67893755) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid.
Molecular Properties
| Compound Name | 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
| PubChem CID | 67893755 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
| SMILES | COC1(O)C=CC(C=CC(=O)O)=CC1 |
| InChI | InChI=1S/C10H12O4/c1-14-10(13)6-4-8(5-7-10)2-3-9(11)12/h2-6,13H,7H2,1H3,(H,11,12) |
| InChIKey | FOAHIDOTQKOQPO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
The IUPAC name of 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid (CID 67893755) is 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid.
What is the SMILES notation for 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
The canonical SMILES for 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid is COC1(O)C=CC(C=CC(=O)O)=CC1.
What is the InChIKey of 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
The InChIKey is FOAHIDOTQKOQPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-14-10(13)6-4-8(5-7-10)2-3-9(11)12/h2-6,13H,7H2,1H3,(H,11,12).
What are the key properties of 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid has a molecular weight of 196.20 g/mol, XLogP of 0.85, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid is sourced from PubChem (CID 67893755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).