3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid

C10H12O4 — CID 67893755

IUPAC3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid
SMILESCOC1(O)C=CC(C=CC(=O)O)=CC1
InChIInChI=1S/C10H12O4/c1-14-10(13)6-4-8(5-7-10)2-3-9(11)12/h2-6,13H,7H2,1H3,(H,11,12)
InChIKeyFOAHIDOTQKOQPO-UHFFFAOYSA-N
MW196.20 g/mol
LogP0.85
Rot. Bonds3

About 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid

3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid (PubChem CID 67893755) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid
PubChem CID67893755
Molecular FormulaC10H12O4
Molecular Weight196.20 g/mol
Exact Mass196.07
IUPAC Name3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid
SMILESCOC1(O)C=CC(C=CC(=O)O)=CC1
InChIInChI=1S/C10H12O4/c1-14-10(13)6-4-8(5-7-10)2-3-9(11)12/h2-6,13H,7H2,1H3,(H,11,12)
InChIKeyFOAHIDOTQKOQPO-UHFFFAOYSA-N
XLogP0.85
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.20
LogP ≤ 50.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
The IUPAC name of 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid (CID 67893755) is 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid.
What is the SMILES notation for 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
The canonical SMILES for 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid is COC1(O)C=CC(C=CC(=O)O)=CC1.
What is the InChIKey of 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
The InChIKey is FOAHIDOTQKOQPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-14-10(13)6-4-8(5-7-10)2-3-9(11)12/h2-6,13H,7H2,1H3,(H,11,12).
What are the key properties of 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid?
3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid has a molecular weight of 196.20 g/mol, XLogP of 0.85, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid is sourced from PubChem (CID 67893755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).