About 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide
3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide (PubChem CID 67893786) has the molecular formula C12H11ClF3NO
and a molecular weight of 277.67 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide |
| PubChem CID | 67893786 |
| Molecular Formula | C12H11ClF3NO |
| Molecular Weight | 277.67 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide |
| SMILES | CC(=CC(=O)NCC(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H11ClF3NO/c1-8(9-3-2-4-10(13)6-9)5-11(18)17-7-12(14,15)16/h2-6H,7H2,1H3,(H,17,18) |
| InChIKey | WYCIXSDPVLLOEB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.67 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide?
The IUPAC name of 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide (CID 67893786) is 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide.
What is the SMILES notation for 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide?
The canonical SMILES for 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide is CC(=CC(=O)NCC(F)(F)F)c1cccc(Cl)c1.
What is the InChIKey of 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide?
The InChIKey is WYCIXSDPVLLOEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClF3NO/c1-8(9-3-2-4-10(13)6-9)5-11(18)17-7-12(14,15)16/h2-6H,7H2,1H3,(H,17,18).
What are the key properties of 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide?
3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide has a molecular weight of 277.67 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-N-(2,2,2-trifluoroethyl)but-2-enamide is sourced from PubChem (CID 67893786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).