C22H29IO3 — CID 67894042
[(8R,9S,10R,13S,14S,17R)-2-ethenyl-17-iodo-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 67894042) has the molecular formula C22H29IO3 and a molecular weight of 468.38 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-2-ethenyl-17-iodo-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-2-ethenyl-17-iodo-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 67894042 |
| Molecular Formula | C22H29IO3 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-2-ethenyl-17-iodo-13-methyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C=CC1C[C@H]2C(=CC1=O)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(I)OC(C)=O |
| InChI | InChI=1S/C22H29IO3/c1-4-14-11-18-15(12-20(14)25)5-6-17-16(18)7-9-21(3)19(17)8-10-22(21,23)26-13(2)24/h4,12,14,16-19H,1,5-11H2,2-3H3/t14?,16-,17+,18-,19-,21-,22-/m0/s1 |
| InChIKey | WJTATEPWXSWWHS-XARUUAODSA-N |
| XLogP | 5.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|