About (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate
(5-methyl-1,3-dioxan-5-yl) hydrogen carbonate (PubChem CID 67894101) has the molecular formula C6H10O5
and a molecular weight of 162.14 g/mol. Its IUPAC name is (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate |
| PubChem CID | 67894101 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate |
| SMILES | CC1(OC(=O)O)COCOC1 |
| InChI | InChI=1S/C6H10O5/c1-6(11-5(7)8)2-9-4-10-3-6/h2-4H2,1H3,(H,7,8) |
| InChIKey | RLISUFCPNRIUEH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate?
The IUPAC name of (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate (CID 67894101) is (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate.
What is the SMILES notation for (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate?
The canonical SMILES for (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate is CC1(OC(=O)O)COCOC1.
What is the InChIKey of (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate?
The InChIKey is RLISUFCPNRIUEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O5/c1-6(11-5(7)8)2-9-4-10-3-6/h2-4H2,1H3,(H,7,8).
What are the key properties of (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate?
(5-methyl-1,3-dioxan-5-yl) hydrogen carbonate has a molecular weight of 162.14 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3-dioxan-5-yl) hydrogen carbonate is sourced from PubChem (CID 67894101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).