About 4-(2-methylphenyl)-2H-triazole;2H-triazole
4-(2-methylphenyl)-2H-triazole;2H-triazole (PubChem CID 67894535) has the molecular formula C11H12N6
and a molecular weight of 228.26 g/mol. Its IUPAC name is 4-(2-methylphenyl)-2H-triazole;2H-triazole.
Molecular Properties
| Compound Name | 4-(2-methylphenyl)-2H-triazole;2H-triazole |
| PubChem CID | 67894535 |
| Molecular Formula | C11H12N6 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-(2-methylphenyl)-2H-triazole;2H-triazole |
| SMILES | Cc1ccccc1-c1cn[nH]n1.c1cn[nH]n1 |
| InChI | InChI=1S/C9H9N3.C2H3N3/c1-7-4-2-3-5-8(7)9-6-10-12-11-9;1-2-4-5-3-1/h2-6H,1H3,(H,10,11,12);1-2H,(H,3,4,5) |
| InChIKey | WGOACAUVQACZRV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-methylphenyl)-2H-triazole;2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylphenyl)-2H-triazole;2H-triazole?
The IUPAC name of 4-(2-methylphenyl)-2H-triazole;2H-triazole (CID 67894535) is 4-(2-methylphenyl)-2H-triazole;2H-triazole.
What is the SMILES notation for 4-(2-methylphenyl)-2H-triazole;2H-triazole?
The canonical SMILES for 4-(2-methylphenyl)-2H-triazole;2H-triazole is Cc1ccccc1-c1cn[nH]n1.c1cn[nH]n1.
What is the InChIKey of 4-(2-methylphenyl)-2H-triazole;2H-triazole?
The InChIKey is WGOACAUVQACZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.C2H3N3/c1-7-4-2-3-5-8(7)9-6-10-12-11-9;1-2-4-5-3-1/h2-6H,1H3,(H,10,11,12);1-2H,(H,3,4,5).
What are the key properties of 4-(2-methylphenyl)-2H-triazole;2H-triazole?
4-(2-methylphenyl)-2H-triazole;2H-triazole has a molecular weight of 228.26 g/mol, XLogP of 1.58, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylphenyl)-2H-triazole;2H-triazole is sourced from PubChem (CID 67894535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).