C20H24ClN — CID 67894852
(3aR,5R,9bR)-3-ethyl-5-phenyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole;hydrochloride (PubChem CID 67894852) has the molecular formula C20H24ClN and a molecular weight of 313.87 g/mol. Its IUPAC name is (3aR,5R,9bR)-3-ethyl-5-phenyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole;hydrochloride.
| Compound Name | (3aR,5R,9bR)-3-ethyl-5-phenyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole;hydrochloride |
|---|---|
| PubChem CID | 67894852 |
| Molecular Formula | C20H24ClN |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (3aR,5R,9bR)-3-ethyl-5-phenyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole;hydrochloride |
| SMILES | CCN1CC[C@@H]2c3ccccc3[C@@H](c3ccccc3)C[C@H]21.Cl |
| InChI | InChI=1S/C20H23N.ClH/c1-2-21-13-12-18-16-10-6-7-11-17(16)19(14-20(18)21)15-8-4-3-5-9-15;/h3-11,18-20H,2,12-14H2,1H3;1H/t18-,19-,20-;/m1./s1 |
| InChIKey | OGNOUQVUYRSMSD-DEXIKXDTSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |