About (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate (PubChem CID 67895035) has the molecular formula C13H18O5
and a molecular weight of 254.28 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate.
Molecular Properties
| Compound Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate |
| PubChem CID | 67895035 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate |
| SMILES | CC/C=C(\CCC)C(=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C13H18O5/c1-4-6-10(7-5-2)12(14)16-8-11-9(3)17-13(15)18-11/h6H,4-5,7-8H2,1-3H3/b10-6+ |
| InChIKey | QGUZAAZDNDERND-UXBLZVDNSA-N |
| XLogP | 2.72 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate?
The IUPAC name of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate (CID 67895035) is (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate.
What is the SMILES notation for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate?
The canonical SMILES for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate is CC/C=C(\CCC)C(=O)OCc1oc(=O)oc1C.
What is the InChIKey of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate?
The InChIKey is QGUZAAZDNDERND-UXBLZVDNSA-N. The full InChI is InChI=1S/C13H18O5/c1-4-6-10(7-5-2)12(14)16-8-11-9(3)17-13(15)18-11/h6H,4-5,7-8H2,1-3H3/b10-6+.
What are the key properties of (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate?
(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate has a molecular weight of 254.28 g/mol, XLogP of 2.72, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl (E)-2-propylpent-2-enoate is sourced from PubChem (CID 67895035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).