About 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid
2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid (PubChem CID 67895119) has the molecular formula C16H15F5N2O3
and a molecular weight of 378.30 g/mol. Its IUPAC name is 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid.
Molecular Properties
| Compound Name | 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid |
| PubChem CID | 67895119 |
| Molecular Formula | C16H15F5N2O3 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid |
| SMILES | CCC(Oc1cccc(C(F)(F)F)n1)C(=O)O.Nc1ccc(F)cc1F |
| InChI | InChI=1S/C10H10F3NO3.C6H5F2N/c1-2-6(9(15)16)17-8-5-3-4-7(14-8)10(11,12)13;7-4-1-2-6(9)5(8)3-4/h3-6H,2H2,1H3,(H,15,16);1-3H,9H2 |
| InChIKey | KSCJMZLYRRUDGR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid?
The IUPAC name of 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid (CID 67895119) is 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid.
What is the SMILES notation for 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid?
The canonical SMILES for 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid is CCC(Oc1cccc(C(F)(F)F)n1)C(=O)O.Nc1ccc(F)cc1F.
What is the InChIKey of 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid?
The InChIKey is KSCJMZLYRRUDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO3.C6H5F2N/c1-2-6(9(15)16)17-8-5-3-4-7(14-8)10(11,12)13;7-4-1-2-6(9)5(8)3-4/h3-6H,2H2,1H3,(H,15,16);1-3H,9H2.
What are the key properties of 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid?
2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid has a molecular weight of 378.30 g/mol, XLogP of 3.89, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoroaniline;2-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butanoic acid is sourced from PubChem (CID 67895119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).