About 2-methylaniline;2H-tetrazole
2-methylaniline;2H-tetrazole (PubChem CID 67895698) has the molecular formula C8H11N5
and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-methylaniline;2H-tetrazole.
Molecular Properties
| Compound Name | 2-methylaniline;2H-tetrazole |
| PubChem CID | 67895698 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 2-methylaniline;2H-tetrazole |
| SMILES | Cc1ccccc1N.c1nn[nH]n1 |
| InChI | InChI=1S/C7H9N.CH2N4/c1-6-4-2-3-5-7(6)8;1-2-4-5-3-1/h2-5H,8H2,1H3;1H,(H,2,3,4,5) |
| InChIKey | RRMAAANSBBFGRW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylaniline;2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylaniline;2H-tetrazole?
The IUPAC name of 2-methylaniline;2H-tetrazole (CID 67895698) is 2-methylaniline;2H-tetrazole.
What is the SMILES notation for 2-methylaniline;2H-tetrazole?
The canonical SMILES for 2-methylaniline;2H-tetrazole is Cc1ccccc1N.c1nn[nH]n1.
What is the InChIKey of 2-methylaniline;2H-tetrazole?
The InChIKey is RRMAAANSBBFGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.CH2N4/c1-6-4-2-3-5-7(6)8;1-2-4-5-3-1/h2-5H,8H2,1H3;1H,(H,2,3,4,5).
What are the key properties of 2-methylaniline;2H-tetrazole?
2-methylaniline;2H-tetrazole has a molecular weight of 177.21 g/mol, XLogP of 0.78, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylaniline;2H-tetrazole is sourced from PubChem (CID 67895698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).