About 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone
2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone (PubChem CID 67895766) has the molecular formula C30H24N2O2
and a molecular weight of 444.53 g/mol. Its IUPAC name is 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone |
| PubChem CID | 67895766 |
| Molecular Formula | C30H24N2O2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone |
| SMILES | O=C(c1ccccc1)c1cccc2c1NCC2.O=C(c1ccccc1)c1cccc2cc[nH]c12 |
| InChI | InChI=1S/C15H13NO.C15H11NO/c2*17-15(12-5-2-1-3-6-12)13-8-4-7-11-9-10-16-14(11)13/h1-8,16H,9-10H2;1-10,16H |
| InChIKey | GCHBUGTULPYJDF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone?
The IUPAC name of 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone (CID 67895766) is 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone.
What is the SMILES notation for 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone?
The canonical SMILES for 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone is O=C(c1ccccc1)c1cccc2c1NCC2.O=C(c1ccccc1)c1cccc2cc[nH]c12.
What is the InChIKey of 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone?
The InChIKey is GCHBUGTULPYJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO.C15H11NO/c2*17-15(12-5-2-1-3-6-12)13-8-4-7-11-9-10-16-14(11)13/h1-8,16H,9-10H2;1-10,16H.
What are the key properties of 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone?
2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone has a molecular weight of 444.53 g/mol, XLogP of 6.28, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indol-7-yl(phenyl)methanone;1H-indol-7-yl(phenyl)methanone is sourced from PubChem (CID 67895766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).