C15H23N — CID 67896966
1-methylidene-2-pentyl-3,4,4a,5-tetrahydroisoquinoline (PubChem CID 67896966) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-methylidene-2-pentyl-3,4,4a,5-tetrahydroisoquinoline.
| Compound Name | 1-methylidene-2-pentyl-3,4,4a,5-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 67896966 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-methylidene-2-pentyl-3,4,4a,5-tetrahydroisoquinoline |
| SMILES | C=C1C2=CC=CCC2CCN1CCCCC |
| InChI | InChI=1S/C15H23N/c1-3-4-7-11-16-12-10-14-8-5-6-9-15(14)13(16)2/h5-6,9,14H,2-4,7-8,10-12H2,1H3 |
| InChIKey | YZKUDIHSXHEHNZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|