About methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate
methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate (PubChem CID 67896998) has the molecular formula C26H30N2O6
and a molecular weight of 466.53 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate |
| PubChem CID | 67896998 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCCN(C)c1ccc(C=Cc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H22N2O4.C5H8O2/c1-16(2)21(24)27-15-14-22(3)19-10-6-17(7-11-19)4-5-18-8-12-20(13-9-18)23(25)26;1-4(2)5(6)7-3/h4-13H,1,14-15H2,2-3H3;1H2,2-3H3 |
| InChIKey | USJOJQSDZCTWAQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate?
The IUPAC name of methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate (CID 67896998) is methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate.
What is the SMILES notation for methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate?
The canonical SMILES for methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.C=C(C)C(=O)OCCN(C)c1ccc(C=Cc2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate?
The InChIKey is USJOJQSDZCTWAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O4.C5H8O2/c1-16(2)21(24)27-15-14-22(3)19-10-6-17(7-11-19)4-5-18-8-12-20(13-9-18)23(25)26;1-4(2)5(6)7-3/h4-13H,1,14-15H2,2-3H3;1H2,2-3H3.
What are the key properties of methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate?
methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate has a molecular weight of 466.53 g/mol, XLogP of 5.06, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylprop-2-enoate;2-[N-methyl-4-[2-(4-nitrophenyl)ethenyl]anilino]ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 67896998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).