C21H30N2 — CID 67897279
10,16-dimethyl-15-(3-methylbut-2-enyl)-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),8-triene (PubChem CID 67897279) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 10,16-dimethyl-15-(3-methylbut-2-enyl)-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),8-triene.
| Compound Name | 10,16-dimethyl-15-(3-methylbut-2-enyl)-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),8-triene |
|---|---|
| PubChem CID | 67897279 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 10,16-dimethyl-15-(3-methylbut-2-enyl)-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-3,5(12),8-triene |
| SMILES | CC(C)=CCC1C2CC3=C4C=C2NC1C(C)C(C)(/C=N\CC4)C3 |
| InChI | InChI=1S/C21H30N2/c1-13(2)5-6-17-18-9-16-11-21(4)12-22-8-7-15(16)10-19(18)23-20(17)14(21)3/h5,10,12,14,17-18,20,23H,6-9,11H2,1-4H3/b22-12- |
| InChIKey | IYCDIMYYBBNRLE-UUYOSTAYSA-N |
| XLogP | 4.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|