C18H28O2 — CID 67897414
(3S)-3-hydroxy-6-(2-methylbutyl)-1,2,3,3a,4,5,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-one (PubChem CID 67897414) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (3S)-3-hydroxy-6-(2-methylbutyl)-1,2,3,3a,4,5,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-one.
| Compound Name | (3S)-3-hydroxy-6-(2-methylbutyl)-1,2,3,3a,4,5,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-one |
|---|---|
| PubChem CID | 67897414 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (3S)-3-hydroxy-6-(2-methylbutyl)-1,2,3,3a,4,5,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-one |
| SMILES | CCC(C)CC1=C2CCC3C(CC[C@@H]3O)C2CCC1=O |
| InChI | InChI=1S/C18H28O2/c1-3-11(2)10-16-14-4-5-15-13(7-8-17(15)19)12(14)6-9-18(16)20/h11-13,15,17,19H,3-10H2,1-2H3/t11?,12?,13?,15?,17-/m0/s1 |
| InChIKey | UHEWNDMKVUTODV-MTDTVKPRSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |