About [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate
[(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate (PubChem CID 67897499) has the molecular formula C12H17ClN2O4
and a molecular weight of 288.73 g/mol. Its IUPAC name is [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate.
Molecular Properties
| Compound Name | [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate |
| PubChem CID | 67897499 |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC1=C(Cl)CC[C@H]2[C@H](N)C(=O)N12 |
| InChI | InChI=1S/C12H17ClN2O4/c1-12(2,3)19-11(17)18-10-6(13)4-5-7-8(14)9(16)15(7)10/h7-8H,4-5,14H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | GGZRJMSNIBBWRG-YUMQZZPRSA-N |
| XLogP | 1.68 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate?
The IUPAC name of [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate (CID 67897499) is [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate.
What is the SMILES notation for [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate?
The canonical SMILES for [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate is CC(C)(C)OC(=O)OC1=C(Cl)CC[C@H]2[C@H](N)C(=O)N12.
What is the InChIKey of [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate?
The InChIKey is GGZRJMSNIBBWRG-YUMQZZPRSA-N. The full InChI is InChI=1S/C12H17ClN2O4/c1-12(2,3)19-11(17)18-10-6(13)4-5-7-8(14)9(16)15(7)10/h7-8H,4-5,14H2,1-3H3/t7-,8-/m0/s1.
What are the key properties of [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate?
[(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate has a molecular weight of 288.73 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(6S,7S)-7-amino-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-en-2-yl] tert-butyl carbonate is sourced from PubChem (CID 67897499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).