C22H20Cl2O7 — CID 67897598
(4-acetyloxy-2,3,7-trimethoxynaphthalen-1-yl) 1,6-dichlorocyclohexa-2,4-diene-1-carboxylate (PubChem CID 67897598) has the molecular formula C22H20Cl2O7 and a molecular weight of 467.30 g/mol. Its IUPAC name is (4-acetyloxy-2,3,7-trimethoxynaphthalen-1-yl) 1,6-dichlorocyclohexa-2,4-diene-1-carboxylate.
| Compound Name | (4-acetyloxy-2,3,7-trimethoxynaphthalen-1-yl) 1,6-dichlorocyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 67897598 |
| Molecular Formula | C22H20Cl2O7 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | (4-acetyloxy-2,3,7-trimethoxynaphthalen-1-yl) 1,6-dichlorocyclohexa-2,4-diene-1-carboxylate |
| SMILES | COc1ccc2c(OC(C)=O)c(OC)c(OC)c(OC(=O)C3(Cl)C=CC=CC3Cl)c2c1 |
| InChI | InChI=1S/C22H20Cl2O7/c1-12(25)30-17-14-9-8-13(27-2)11-15(14)18(20(29-4)19(17)28-3)31-21(26)22(24)10-6-5-7-16(22)23/h5-11,16H,1-4H3 |
| InChIKey | FJYCJIGQQKHEQA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|