About 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione
5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione (PubChem CID 67897627) has the molecular formula C16H17I2NO3
and a molecular weight of 525.12 g/mol. Its IUPAC name is 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione |
| PubChem CID | 67897627 |
| Molecular Formula | C16H17I2NO3 |
| Molecular Weight | 525.12 g/mol |
| Exact Mass | 524.93 |
| IUPAC Name | 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione |
| SMILES | CCCC(I)C(I)COC1=CC(=O)c2c(N)cccc2C1=O |
| InChI | InChI=1S/C16H17I2NO3/c1-2-4-10(17)11(18)8-22-14-7-13(20)15-9(16(14)21)5-3-6-12(15)19/h3,5-7,10-11H,2,4,8,19H2,1H3 |
| InChIKey | WTSFEFZWEBPOSY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 525.12 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione?
The IUPAC name of 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione (CID 67897627) is 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione.
What is the SMILES notation for 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione?
The canonical SMILES for 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione is CCCC(I)C(I)COC1=CC(=O)c2c(N)cccc2C1=O.
What is the InChIKey of 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione?
The InChIKey is WTSFEFZWEBPOSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17I2NO3/c1-2-4-10(17)11(18)8-22-14-7-13(20)15-9(16(14)21)5-3-6-12(15)19/h3,5-7,10-11H,2,4,8,19H2,1H3.
What are the key properties of 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione?
5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione has a molecular weight of 525.12 g/mol, XLogP of 3.96, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(2,3-diiodohexoxy)naphthalene-1,4-dione is sourced from PubChem (CID 67897627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).