C18H29NO2 — CID 67897649
2-decyl-3a,4,5,6-tetrahydroisoindole-1,3-dione (PubChem CID 67897649) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-decyl-3a,4,5,6-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-decyl-3a,4,5,6-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 67897649 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-decyl-3a,4,5,6-tetrahydroisoindole-1,3-dione |
| SMILES | CCCCCCCCCCN1C(=O)C2=CCCCC2C1=O |
| InChI | InChI=1S/C18H29NO2/c1-2-3-4-5-6-7-8-11-14-19-17(20)15-12-9-10-13-16(15)18(19)21/h12,16H,2-11,13-14H2,1H3 |
| InChIKey | XZRCRZXXOKBXGM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|