About 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione
2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione (PubChem CID 67897734) has the molecular formula C16H15I2NO5
and a molecular weight of 555.11 g/mol. Its IUPAC name is 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione |
| PubChem CID | 67897734 |
| Molecular Formula | C16H15I2NO5 |
| Molecular Weight | 555.11 g/mol |
| Exact Mass | 554.90 |
| IUPAC Name | 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione |
| SMILES | CCCC(I)C(I)COC1=CC(=O)c2cc([N+](=O)[O-])ccc2C1=O |
| InChI | InChI=1S/C16H15I2NO5/c1-2-3-12(17)13(18)8-24-15-7-14(20)11-6-9(19(22)23)4-5-10(11)16(15)21/h4-7,12-13H,2-3,8H2,1H3 |
| InChIKey | XLODRBGYLOEKHL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 555.11 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione?
The IUPAC name of 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione (CID 67897734) is 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione.
What is the SMILES notation for 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione?
The canonical SMILES for 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione is CCCC(I)C(I)COC1=CC(=O)c2cc([N+](=O)[O-])ccc2C1=O.
What is the InChIKey of 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione?
The InChIKey is XLODRBGYLOEKHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15I2NO5/c1-2-3-12(17)13(18)8-24-15-7-14(20)11-6-9(19(22)23)4-5-10(11)16(15)21/h4-7,12-13H,2-3,8H2,1H3.
What are the key properties of 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione?
2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione has a molecular weight of 555.11 g/mol, XLogP of 4.28, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-diiodohexoxy)-6-nitronaphthalene-1,4-dione is sourced from PubChem (CID 67897734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).