C28H38O3 — CID 67897758
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-6-methylidene-3-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] 3-cyclopentylpropanoate (PubChem CID 67897758) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-6-methylidene-3-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] 3-cyclopentylpropanoate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-6-methylidene-3-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 67897758 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-6-methylidene-3-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] 3-cyclopentylpropanoate |
| SMILES | C=C1C[C@H]2[C@@H]3CC[C@H](OC(=O)CCC4CCCC4)[C@@]3(C)CC[C@@H]2[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C28H38O3/c1-18-16-21-22-9-10-25(31-26(30)11-8-19-6-4-5-7-19)28(22,3)15-13-23(21)27(2)14-12-20(29)17-24(18)27/h12,14,17,19,21-23,25H,1,4-11,13,15-16H2,2-3H3/t21-,22-,23-,25-,27+,28-/m0/s1 |
| InChIKey | UCEOTMXTLITPQT-RCDOGVRQSA-N |
| XLogP | 6.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |