About [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate
[4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate (PubChem CID 67897809) has the molecular formula C22H22O6
and a molecular weight of 382.41 g/mol. Its IUPAC name is [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate.
Molecular Properties
| Compound Name | [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate |
| PubChem CID | 67897809 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate |
| SMILES | COc1c(OC)c(OC(C)=O)c2ccc(OC(C)c3ccccc3)cc2c1O |
| InChI | InChI=1S/C22H22O6/c1-13(15-8-6-5-7-9-15)27-16-10-11-17-18(12-16)19(24)21(25-3)22(26-4)20(17)28-14(2)23/h5-13,24H,1-4H3 |
| InChIKey | HKFPKYSVZXJMRD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate?
The IUPAC name of [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate (CID 67897809) is [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate.
What is the SMILES notation for [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate?
The canonical SMILES for [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate is COc1c(OC)c(OC(C)=O)c2ccc(OC(C)c3ccccc3)cc2c1O.
What is the InChIKey of [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate?
The InChIKey is HKFPKYSVZXJMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O6/c1-13(15-8-6-5-7-9-15)27-16-10-11-17-18(12-16)19(24)21(25-3)22(26-4)20(17)28-14(2)23/h5-13,24H,1-4H3.
What are the key properties of [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate?
[4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate has a molecular weight of 382.41 g/mol, XLogP of 4.63, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-hydroxy-2,3-dimethoxy-6-(1-phenylethoxy)naphthalen-1-yl] acetate is sourced from PubChem (CID 67897809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).