C16H24N2O — CID 67898233
3,3,5,5-tetrakis(prop-2-enyl)piperazin-2-one (PubChem CID 67898233) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3,3,5,5-tetrakis(prop-2-enyl)piperazin-2-one.
| Compound Name | 3,3,5,5-tetrakis(prop-2-enyl)piperazin-2-one |
|---|---|
| PubChem CID | 67898233 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3,3,5,5-tetrakis(prop-2-enyl)piperazin-2-one |
| SMILES | C=CCC1(CC=C)CNC(=O)C(CC=C)(CC=C)N1 |
| InChI | InChI=1S/C16H24N2O/c1-5-9-15(10-6-2)13-17-14(19)16(18-15,11-7-3)12-8-4/h5-8,18H,1-4,9-13H2,(H,17,19) |
| InChIKey | WJIGZJPUFFCMFI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|