C20H20Cl3N5O4S — CID 67898461
1,1,2-trichloroethyl (2S,3S,5R,6R)-3-methyl-7-oxo-6-[(2-phenylacetyl)amino]-3-(triazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 67898461) has the molecular formula C20H20Cl3N5O4S and a molecular weight of 532.84 g/mol. Its IUPAC name is 1,1,2-trichloroethyl (2S,3S,5R,6R)-3-methyl-7-oxo-6-[(2-phenylacetyl)amino]-3-(triazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 1,1,2-trichloroethyl (2S,3S,5R,6R)-3-methyl-7-oxo-6-[(2-phenylacetyl)amino]-3-(triazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 67898461 |
| Molecular Formula | C20H20Cl3N5O4S |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 531.03 |
| IUPAC Name | 1,1,2-trichloroethyl (2S,3S,5R,6R)-3-methyl-7-oxo-6-[(2-phenylacetyl)amino]-3-(triazol-1-ylmethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@]1(Cn2ccnn2)S[C@@H]2[C@H](NC(=O)Cc3ccccc3)C(=O)N2[C@H]1C(=O)OC(Cl)(Cl)CCl |
| InChI | InChI=1S/C20H20Cl3N5O4S/c1-19(11-27-8-7-24-26-27)15(18(31)32-20(22,23)10-21)28-16(30)14(17(28)33-19)25-13(29)9-12-5-3-2-4-6-12/h2-8,14-15,17H,9-11H2,1H3,(H,25,29)/t14-,15+,17-,19+/m1/s1 |
| InChIKey | LZKWKHGQPCWIMS-GFIVTLFCSA-N |
| XLogP | 1.96 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|