C45H87N9O3 — CID 67898778
1-[4-[[4,6-bis[ethyl-[1-(1-hydroxypropyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-ethylamino]-2,2,6,6-tetramethylpiperidin-1-yl]propan-1-ol (PubChem CID 67898778) has the molecular formula C45H87N9O3 and a molecular weight of 802.25 g/mol. Its IUPAC name is 1-[4-[[4,6-bis[ethyl-[1-(1-hydroxypropyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-ethylamino]-2,2,6,6-tetramethylpiperidin-1-yl]propan-1-ol.
| Compound Name | 1-[4-[[4,6-bis[ethyl-[1-(1-hydroxypropyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-ethylamino]-2,2,6,6-tetramethylpiperidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 67898778 |
| Molecular Formula | C45H87N9O3 |
| Molecular Weight | 802.25 g/mol |
| Exact Mass | 801.69 |
| IUPAC Name | 1-[4-[[4,6-bis[ethyl-[1-(1-hydroxypropyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-ethylamino]-2,2,6,6-tetramethylpiperidin-1-yl]propan-1-ol |
| SMILES | CCC(O)N1C(C)(C)CC(N(CC)c2nc(N(CC)C3CC(C)(C)N(C(O)CC)C(C)(C)C3)nc(N(CC)C3CC(C)(C)N(C(O)CC)C(C)(C)C3)n2)CC1(C)C |
| InChI | InChI=1S/C45H87N9O3/c1-19-34(55)52-40(7,8)25-31(26-41(52,9)10)49(22-4)37-46-38(50(23-5)32-27-42(11,12)53(35(56)20-2)43(13,14)28-32)48-39(47-37)51(24-6)33-29-44(15,16)54(36(57)21-3)45(17,18)30-33/h31-36,55-57H,19-30H2,1-18H3 |
| InChIKey | AIEQOVGDQPABKC-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.25 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |