C48H93N9O3 — CID 67898828
1-[4-[[4,6-bis[butyl-[1-(1-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-butylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol (PubChem CID 67898828) has the molecular formula C48H93N9O3 and a molecular weight of 844.33 g/mol. Its IUPAC name is 1-[4-[[4,6-bis[butyl-[1-(1-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-butylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol.
| Compound Name | 1-[4-[[4,6-bis[butyl-[1-(1-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-butylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 67898828 |
| Molecular Formula | C48H93N9O3 |
| Molecular Weight | 844.33 g/mol |
| Exact Mass | 843.74 |
| IUPAC Name | 1-[4-[[4,6-bis[butyl-[1-(1-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-butylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol |
| SMILES | CCCCN(c1nc(N(CCCC)C2CC(C)(C)N(C(C)O)C(C)(C)C2)nc(N(CCCC)C2CC(C)(C)N(C(C)O)C(C)(C)C2)n1)C1CC(C)(C)N(C(C)O)C(C)(C)C1 |
| InChI | InChI=1S/C48H93N9O3/c1-19-22-25-52(37-28-43(7,8)55(34(4)58)44(9,10)29-37)40-49-41(53(26-23-20-2)38-30-45(11,12)56(35(5)59)46(13,14)31-38)51-42(50-40)54(27-24-21-3)39-32-47(15,16)57(36(6)60)48(17,18)33-39/h34-39,58-60H,19-33H2,1-18H3 |
| InChIKey | YHFYFCSIHJLBGI-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.33 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |