C24H28ClN3O3 — CID 67898994
[(6aR,9R,10aS)-10a-methoxy-4,7-dimethyl-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]methyl pyridine-3-carboxylate;hydrochloride (PubChem CID 67898994) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is [(6aR,9R,10aS)-10a-methoxy-4,7-dimethyl-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]methyl pyridine-3-carboxylate;hydrochloride.
| Compound Name | [(6aR,9R,10aS)-10a-methoxy-4,7-dimethyl-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]methyl pyridine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 67898994 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | [(6aR,9R,10aS)-10a-methoxy-4,7-dimethyl-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]methyl pyridine-3-carboxylate;hydrochloride |
| SMILES | CO[C@]12C[C@@H](COC(=O)c3cccnc3)CN(C)[C@@H]1Cc1cn(C)c3cccc2c13.Cl |
| InChI | InChI=1S/C24H27N3O3.ClH/c1-26-14-18-10-21-24(29-3,19-7-4-8-20(26)22(18)19)11-16(13-27(21)2)15-30-23(28)17-6-5-9-25-12-17;/h4-9,12,14,16,21H,10-11,13,15H2,1-3H3;1H/t16-,21-,24+;/m1./s1 |
| InChIKey | AVSNWTVGOOZURC-PTMFYGODSA-N |
| XLogP | 3.57 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|