About 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane
4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane (PubChem CID 67899079) has the molecular formula C34H48N4O2
and a molecular weight of 544.78 g/mol. Its IUPAC name is 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane.
Molecular Properties
| Compound Name | 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane |
| PubChem CID | 67899079 |
| Molecular Formula | C34H48N4O2 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane |
| SMILES | CCOCC.CCOCC.Cc1cc(-c2ccc(N)c(C)c2)ccc1N.Nc1cccc(-c2cccc(N)c2)c1 |
| InChI | InChI=1S/C14H16N2.C12H12N2.2C4H10O/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12;13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10;2*1-3-5-4-2/h3-8H,15-16H2,1-2H3;1-8H,13-14H2;2*3-4H2,1-2H3 |
| InChIKey | IEIACHADRNJYCL-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane?
The IUPAC name of 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane (CID 67899079) is 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane.
What is the SMILES notation for 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane?
The canonical SMILES for 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane is CCOCC.CCOCC.Cc1cc(-c2ccc(N)c(C)c2)ccc1N.Nc1cccc(-c2cccc(N)c2)c1.
What is the InChIKey of 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane?
The InChIKey is IEIACHADRNJYCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2.C12H12N2.2C4H10O/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12;13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10;2*1-3-5-4-2/h3-8H,15-16H2,1-2H3;1-8H,13-14H2;2*3-4H2,1-2H3.
What are the key properties of 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane?
4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane has a molecular weight of 544.78 g/mol, XLogP of 7.74, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3-methylphenyl)-2-methylaniline;3-(3-aminophenyl)aniline;ethoxyethane is sourced from PubChem (CID 67899079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).