About 3,1,5-benzothiadiazepine
3,1,5-benzothiadiazepine (PubChem CID 67899940) has the molecular formula C8H6N2S
and a molecular weight of 162.22 g/mol. Its IUPAC name is 3,1,5-benzothiadiazepine.
Molecular Properties
| Compound Name | 3,1,5-benzothiadiazepine |
| PubChem CID | 67899940 |
| Molecular Formula | C8H6N2S |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 3,1,5-benzothiadiazepine |
| SMILES | C1=Nc2ccccc2N=CS1 |
| InChI | InChI=1S/C8H6N2S/c1-2-4-8-7(3-1)9-5-11-6-10-8/h1-6H |
| InChIKey | WQAVYNTYZRXINS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,1,5-benzothiadiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,1,5-benzothiadiazepine?
The IUPAC name of 3,1,5-benzothiadiazepine (CID 67899940) is 3,1,5-benzothiadiazepine.
What is the SMILES notation for 3,1,5-benzothiadiazepine?
The canonical SMILES for 3,1,5-benzothiadiazepine is C1=Nc2ccccc2N=CS1.
What is the InChIKey of 3,1,5-benzothiadiazepine?
The InChIKey is WQAVYNTYZRXINS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S/c1-2-4-8-7(3-1)9-5-11-6-10-8/h1-6H.
What are the key properties of 3,1,5-benzothiadiazepine?
3,1,5-benzothiadiazepine has a molecular weight of 162.22 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,1,5-benzothiadiazepine is sourced from PubChem (CID 67899940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).