C21H33NO4 — CID 67900201
2-[amino-(2,2,5-trimethyl-1,3-dioxan-5-yl)methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol (PubChem CID 67900201) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-[amino-(2,2,5-trimethyl-1,3-dioxan-5-yl)methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 2-[amino-(2,2,5-trimethyl-1,3-dioxan-5-yl)methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 67900201 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 2-[amino-(2,2,5-trimethyl-1,3-dioxan-5-yl)methyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C(N)C1(C)COC(C)(C)OC1)O2 |
| InChI | InChI=1S/C21H33NO4/c1-12-13(2)17-15(14(3)16(12)23)8-9-21(7,26-17)18(22)20(6)10-24-19(4,5)25-11-20/h18,23H,8-11,22H2,1-7H3 |
| InChIKey | YUBCNEUGKUGDMJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |