About (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate
(7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate (PubChem CID 67900250) has the molecular formula C17H23NO4
and a molecular weight of 305.37 g/mol. Its IUPAC name is (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate.
Molecular Properties
| Compound Name | (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate |
| PubChem CID | 67900250 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate |
| SMILES | CC(=O)Oc1cc2c(cc1C(C)(C)C)OC(C)(C(N)=O)CC2 |
| InChI | InChI=1S/C17H23NO4/c1-10(19)21-14-8-11-6-7-17(5,15(18)20)22-13(11)9-12(14)16(2,3)4/h8-9H,6-7H2,1-5H3,(H2,18,20) |
| InChIKey | GROXKMPLTPECGU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate?
The IUPAC name of (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate (CID 67900250) is (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate.
What is the SMILES notation for (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate?
The canonical SMILES for (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate is CC(=O)Oc1cc2c(cc1C(C)(C)C)OC(C)(C(N)=O)CC2.
What is the InChIKey of (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate?
The InChIKey is GROXKMPLTPECGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4/c1-10(19)21-14-8-11-6-7-17(5,15(18)20)22-13(11)9-12(14)16(2,3)4/h8-9H,6-7H2,1-5H3,(H2,18,20).
What are the key properties of (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate?
(7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate has a molecular weight of 305.37 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-tert-butyl-2-carbamoyl-2-methyl-3,4-dihydrochromen-6-yl) acetate is sourced from PubChem (CID 67900250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).