C19H25NO2 — CID 67900798
3-[(3R,4S)-3,4-dimethylpiperidin-4-yl]phenol;phenol (PubChem CID 67900798) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 3-[(3R,4S)-3,4-dimethylpiperidin-4-yl]phenol;phenol.
| Compound Name | 3-[(3R,4S)-3,4-dimethylpiperidin-4-yl]phenol;phenol |
|---|---|
| PubChem CID | 67900798 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 3-[(3R,4S)-3,4-dimethylpiperidin-4-yl]phenol;phenol |
| SMILES | C[C@H]1CNCC[C@]1(C)c1cccc(O)c1.Oc1ccccc1 |
| InChI | InChI=1S/C13H19NO.C6H6O/c1-10-9-14-7-6-13(10,2)11-4-3-5-12(15)8-11;7-6-4-2-1-3-5-6/h3-5,8,10,14-15H,6-7,9H2,1-2H3;1-5,7H/t10-,13-;/m0./s1 |
| InChIKey | YMVPOXZGAFLLNQ-VVBGOIRUSA-N |
| XLogP | 3.67 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |