C33H37FN2O5 — CID 67900852
[4-[1-(4-fluorophenyl)-4-[(2S,4S)-4-hydroxy-6-oxooxan-2-yl]butyl]-5,5-dimethylcyclohex-3-en-1-yl] N-quinolin-3-ylcarbamate (PubChem CID 67900852) has the molecular formula C33H37FN2O5 and a molecular weight of 560.67 g/mol. Its IUPAC name is [4-[1-(4-fluorophenyl)-4-[(2S,4S)-4-hydroxy-6-oxooxan-2-yl]butyl]-5,5-dimethylcyclohex-3-en-1-yl] N-quinolin-3-ylcarbamate.
| Compound Name | [4-[1-(4-fluorophenyl)-4-[(2S,4S)-4-hydroxy-6-oxooxan-2-yl]butyl]-5,5-dimethylcyclohex-3-en-1-yl] N-quinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 67900852 |
| Molecular Formula | C33H37FN2O5 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | [4-[1-(4-fluorophenyl)-4-[(2S,4S)-4-hydroxy-6-oxooxan-2-yl]butyl]-5,5-dimethylcyclohex-3-en-1-yl] N-quinolin-3-ylcarbamate |
| SMILES | CC1(C)CC(OC(=O)Nc2cnc3ccccc3c2)CC=C1C(CCC[C@H]1C[C@H](O)CC(=O)O1)c1ccc(F)cc1 |
| InChI | InChI=1S/C33H37FN2O5/c1-33(2)19-27(41-32(39)36-24-16-22-6-3-4-9-30(22)35-20-24)14-15-29(33)28(21-10-12-23(34)13-11-21)8-5-7-26-17-25(37)18-31(38)40-26/h3-4,6,9-13,15-16,20,25-28,37H,5,7-8,14,17-19H2,1-2H3,(H,36,39)/t25-,26-,27?,28?/m0/s1 |
| InChIKey | ZWURNNDUMNEZMQ-DZKOAGKBSA-N |
| XLogP | 7.06 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|