About 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride
1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride (PubChem CID 67900917) has the molecular formula C5H11ClN4S
and a molecular weight of 194.69 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride |
| PubChem CID | 67900917 |
| Molecular Formula | C5H11ClN4S |
| Molecular Weight | 194.69 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride |
| SMILES | CC(C)Cn1[nH]nnc1=S.Cl |
| InChI | InChI=1S/C5H10N4S.ClH/c1-4(2)3-9-5(10)6-7-8-9;/h4H,3H2,1-2H3,(H,6,8,10);1H |
| InChIKey | HKDBHLWUNIKXIA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.69 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride?
The IUPAC name of 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride (CID 67900917) is 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride.
What is the SMILES notation for 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride?
The canonical SMILES for 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride is CC(C)Cn1[nH]nnc1=S.Cl.
What is the InChIKey of 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride?
The InChIKey is HKDBHLWUNIKXIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4S.ClH/c1-4(2)3-9-5(10)6-7-8-9;/h4H,3H2,1-2H3,(H,6,8,10);1H.
What are the key properties of 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride?
1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride has a molecular weight of 194.69 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylpropyl)-2H-tetrazole-5-thione;hydrochloride is sourced from PubChem (CID 67900917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).