About 2,4,5-trimethyl-1H-imidazole;hydrochloride
2,4,5-trimethyl-1H-imidazole;hydrochloride (PubChem CID 67901281) has the molecular formula C6H11ClN2
and a molecular weight of 146.62 g/mol. Its IUPAC name is 2,4,5-trimethyl-1H-imidazole;hydrochloride.
Molecular Properties
| Compound Name | 2,4,5-trimethyl-1H-imidazole;hydrochloride |
| PubChem CID | 67901281 |
| Molecular Formula | C6H11ClN2 |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2,4,5-trimethyl-1H-imidazole;hydrochloride |
| SMILES | Cc1nc(C)c(C)[nH]1.Cl |
| InChI | InChI=1S/C6H10N2.ClH/c1-4-5(2)8-6(3)7-4;/h1-3H3,(H,7,8);1H |
| InChIKey | NZXNIRRRIOMHIE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4,5-trimethyl-1H-imidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trimethyl-1H-imidazole;hydrochloride?
The IUPAC name of 2,4,5-trimethyl-1H-imidazole;hydrochloride (CID 67901281) is 2,4,5-trimethyl-1H-imidazole;hydrochloride.
What is the SMILES notation for 2,4,5-trimethyl-1H-imidazole;hydrochloride?
The canonical SMILES for 2,4,5-trimethyl-1H-imidazole;hydrochloride is Cc1nc(C)c(C)[nH]1.Cl.
What is the InChIKey of 2,4,5-trimethyl-1H-imidazole;hydrochloride?
The InChIKey is NZXNIRRRIOMHIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.ClH/c1-4-5(2)8-6(3)7-4;/h1-3H3,(H,7,8);1H.
What are the key properties of 2,4,5-trimethyl-1H-imidazole;hydrochloride?
2,4,5-trimethyl-1H-imidazole;hydrochloride has a molecular weight of 146.62 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trimethyl-1H-imidazole;hydrochloride is sourced from PubChem (CID 67901281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).