C13H19N — CID 67901449
1-(2-methylprop-2-enyl)-3,4,4a,5-tetrahydro-2H-quinoline (PubChem CID 67901449) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-3,4,4a,5-tetrahydro-2H-quinoline.
| Compound Name | 1-(2-methylprop-2-enyl)-3,4,4a,5-tetrahydro-2H-quinoline |
|---|---|
| PubChem CID | 67901449 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-3,4,4a,5-tetrahydro-2H-quinoline |
| SMILES | C=C(C)CN1CCCC2CC=CC=C21 |
| InChI | InChI=1S/C13H19N/c1-11(2)10-14-9-5-7-12-6-3-4-8-13(12)14/h3-4,8,12H,1,5-7,9-10H2,2H3 |
| InChIKey | PXNFVXNICYWDMK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|