About 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine
6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine (PubChem CID 67901511) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine |
| PubChem CID | 67901511 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine |
| SMILES | CCc1cc2[nH]c(C)cc2cn1 |
| InChI | InChI=1S/C10H12N2/c1-3-9-5-10-8(6-11-9)4-7(2)12-10/h4-6,12H,3H2,1-2H3 |
| InChIKey | XEDDUFIAMAMNCR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine?
The IUPAC name of 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine (CID 67901511) is 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine.
What is the SMILES notation for 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine?
The canonical SMILES for 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine is CCc1cc2[nH]c(C)cc2cn1.
What is the InChIKey of 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine?
The InChIKey is XEDDUFIAMAMNCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-3-9-5-10-8(6-11-9)4-7(2)12-10/h4-6,12H,3H2,1-2H3.
What are the key properties of 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine?
6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine has a molecular weight of 160.22 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-methyl-1H-pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 67901511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).