C21H24N2O4 — CID 67901820
benzyl N-[4-[2-(2,2-dimethylpropanoylamino)-2-oxoethyl]phenyl]carbamate (PubChem CID 67901820) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is benzyl N-[4-[2-(2,2-dimethylpropanoylamino)-2-oxoethyl]phenyl]carbamate.
| Compound Name | benzyl N-[4-[2-(2,2-dimethylpropanoylamino)-2-oxoethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67901820 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | benzyl N-[4-[2-(2,2-dimethylpropanoylamino)-2-oxoethyl]phenyl]carbamate |
| SMILES | CC(C)(C)C(=O)NC(=O)Cc1ccc(NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-21(2,3)19(25)23-18(24)13-15-9-11-17(12-10-15)22-20(26)27-14-16-7-5-4-6-8-16/h4-12H,13-14H2,1-3H3,(H,22,26)(H,23,24,25) |
| InChIKey | DZWQIDVLXOMOJL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |